C24H25ClN2O6S — CID 73380730
methyl 2-[2-chloro-4-[[3-(2-ethoxyethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetate (PubChem CID 73380730) has the molecular formula C24H25ClN2O6S and a molecular weight of 504.99 g/mol. Its IUPAC name is methyl 2-[2-chloro-4-[[3-(2-ethoxyethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[2-chloro-4-[[3-(2-ethoxyethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 73380730 |
| Molecular Formula | C24H25ClN2O6S |
| Molecular Weight | 504.99 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | methyl 2-[2-chloro-4-[[3-(2-ethoxyethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetate |
| SMILES | CCOCCN1C(=O)C(=Cc2cc(Cl)c(OCC(=O)OC)c(OC)c2)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C24H25ClN2O6S/c1-4-32-11-10-27-23(29)20(34-24(27)26-17-8-6-5-7-9-17)14-16-12-18(25)22(19(13-16)30-2)33-15-21(28)31-3/h5-9,12-14H,4,10-11,15H2,1-3H3/b20-14?,26-24- |
| InChIKey | SFEHSPDTKBLQDK-SBKIPWIHSA-N |
| XLogP | 4.54 |
| TPSA | 86.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.99 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|