C28H26ClN3O5S — CID 126237698
2-[2-chloro-4-[(E)-[3-ethyl-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]-N-phenylacetamide (PubChem CID 126237698) has the molecular formula C28H26ClN3O5S and a molecular weight of 552.05 g/mol. Its IUPAC name is 2-[2-chloro-4-[(E)-[3-ethyl-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-chloro-4-[(E)-[3-ethyl-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126237698 |
| Molecular Formula | C28H26ClN3O5S |
| Molecular Weight | 552.05 g/mol |
| Exact Mass | 551.13 |
| IUPAC Name | 2-[2-chloro-4-[(E)-[3-ethyl-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]-N-phenylacetamide |
| SMILES | CCN1C(=O)/C(=C\c2cc(Cl)c(OCC(=O)Nc3ccccc3)c(OC)c2)S/C1=N\c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H26ClN3O5S/c1-4-32-27(34)24(38-28(32)31-20-10-12-21(35-2)13-11-20)16-18-14-22(29)26(23(15-18)36-3)37-17-25(33)30-19-8-6-5-7-9-19/h5-16H,4,17H2,1-3H3,(H,30,33)/b24-16+,31-28- |
| InChIKey | JNBLNWVGAMUDEQ-OELMHXBLSA-N |
| XLogP | 6.00 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.05 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|