C26H21ClFN3O3S — CID 126252233
2-[2-chloro-4-[(E)-[3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-phenylacetamide (PubChem CID 126252233) has the molecular formula C26H21ClFN3O3S and a molecular weight of 509.99 g/mol. Its IUPAC name is 2-[2-chloro-4-[(E)-[3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-chloro-4-[(E)-[3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126252233 |
| Molecular Formula | C26H21ClFN3O3S |
| Molecular Weight | 509.99 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | 2-[2-chloro-4-[(E)-[3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-phenylacetamide |
| SMILES | CCN1C(=O)/C(=C\c2ccc(OCC(=O)Nc3ccccc3)c(Cl)c2)S/C1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C26H21ClFN3O3S/c1-2-31-25(33)23(35-26(31)30-20-11-9-18(28)10-12-20)15-17-8-13-22(21(27)14-17)34-16-24(32)29-19-6-4-3-5-7-19/h3-15H,2,16H2,1H3,(H,29,32)/b23-15+,30-26- |
| InChIKey | DEVJGCYMMMCQKM-WIDZUYMKSA-N |
| XLogP | 6.12 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.99 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|