C30H23ClFN3O5S — CID 126386934
2-[2-chloro-4-[(Z)-[3-(furan-2-ylmethyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2-fluorophenyl)acetamide (PubChem CID 126386934) has the molecular formula C30H23ClFN3O5S and a molecular weight of 592.05 g/mol. Its IUPAC name is 2-[2-chloro-4-[(Z)-[3-(furan-2-ylmethyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[2-chloro-4-[(Z)-[3-(furan-2-ylmethyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126386934 |
| Molecular Formula | C30H23ClFN3O5S |
| Molecular Weight | 592.05 g/mol |
| Exact Mass | 591.10 |
| IUPAC Name | 2-[2-chloro-4-[(Z)-[3-(furan-2-ylmethyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2-fluorophenyl)acetamide |
| SMILES | COc1ccc(/N=C2\S/C(=C\c3ccc(OCC(=O)Nc4ccccc4F)c(Cl)c3)C(=O)N2Cc2ccco2)cc1 |
| InChI | InChI=1S/C30H23ClFN3O5S/c1-38-21-11-9-20(10-12-21)33-30-35(17-22-5-4-14-39-22)29(37)27(41-30)16-19-8-13-26(23(31)15-19)40-18-28(36)34-25-7-3-2-6-24(25)32/h2-16H,17-18H2,1H3,(H,34,36)/b27-16-,33-30- |
| InChIKey | KPGUAEDMXXXEGT-HNBXOEHBSA-N |
| XLogP | 6.90 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.05 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|