C25H19ClFN3O3S — CID 135410805
2-[2-chloro-4-[[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2-fluorophenyl)acetamide (PubChem CID 135410805) has the molecular formula C25H19ClFN3O3S and a molecular weight of 495.96 g/mol. Its IUPAC name is 2-[2-chloro-4-[[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[2-chloro-4-[[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 135410805 |
| Molecular Formula | C25H19ClFN3O3S |
| Molecular Weight | 495.96 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | 2-[2-chloro-4-[[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2-fluorophenyl)acetamide |
| SMILES | Cc1ccc(/N=C2/NC(=O)C(=Cc3ccc(OCC(=O)Nc4ccccc4F)c(Cl)c3)S2)cc1 |
| InChI | InChI=1S/C25H19ClFN3O3S/c1-15-6-9-17(10-7-15)28-25-30-24(32)22(34-25)13-16-8-11-21(18(26)12-16)33-14-23(31)29-20-5-3-2-4-19(20)27/h2-13H,14H2,1H3,(H,29,31)(H,28,30,32) |
| InChIKey | NKZYFIPFZKBNSV-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.96 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|