C24H16Cl3N3O3S — CID 137073983
2-[2-chloro-4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide (PubChem CID 137073983) has the molecular formula C24H16Cl3N3O3S and a molecular weight of 532.84 g/mol. Its IUPAC name is 2-[2-chloro-4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[2-chloro-4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 137073983 |
| Molecular Formula | C24H16Cl3N3O3S |
| Molecular Weight | 532.84 g/mol |
| Exact Mass | 531.00 |
| IUPAC Name | 2-[2-chloro-4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide |
| SMILES | O=C(COc1ccc(/C=C2\S/C(=N/c3ccc(Cl)cc3)NC2=O)cc1Cl)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H16Cl3N3O3S/c25-15-2-6-17(7-3-15)28-22(31)13-33-20-10-1-14(11-19(20)27)12-21-23(32)30-24(34-21)29-18-8-4-16(26)5-9-18/h1-12H,13H2,(H,28,31)(H,29,30,32)/b21-12- |
| InChIKey | GOEIXUMJDWFBPX-MTJSOVHGSA-N |
| XLogP | 6.56 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.84 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|