C18H13BrClN3O3S — CID 135537351
2-[4-[[2-(4-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-chlorophenoxy]acetamide (PubChem CID 135537351) has the molecular formula C18H13BrClN3O3S and a molecular weight of 466.74 g/mol. Its IUPAC name is 2-[4-[[2-(4-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-chlorophenoxy]acetamide.
| Compound Name | 2-[4-[[2-(4-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-chlorophenoxy]acetamide |
|---|---|
| PubChem CID | 135537351 |
| Molecular Formula | C18H13BrClN3O3S |
| Molecular Weight | 466.74 g/mol |
| Exact Mass | 464.95 |
| IUPAC Name | 2-[4-[[2-(4-bromophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-chlorophenoxy]acetamide |
| SMILES | NC(=O)COc1ccc(C=C2S/C(=N\c3ccc(Br)cc3)NC2=O)cc1Cl |
| InChI | InChI=1S/C18H13BrClN3O3S/c19-11-2-4-12(5-3-11)22-18-23-17(25)15(27-18)8-10-1-6-14(13(20)7-10)26-9-16(21)24/h1-8H,9H2,(H2,21,24)(H,22,23,25) |
| InChIKey | RVVGHDKLYLKGPY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.74 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|