C20H16ClN2O5S- — CID 135991995
2-[2-chloro-4-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 135991995) has the molecular formula C20H16ClN2O5S- and a molecular weight of 431.88 g/mol. Its IUPAC name is 2-[2-chloro-4-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[2-chloro-4-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 135991995 |
| Molecular Formula | C20H16ClN2O5S- |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 2-[2-chloro-4-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOc1ccc(/N=C2/NC(=O)/C(=C\c3ccc(OCC(=O)[O-])c(Cl)c3)S2)cc1 |
| InChI | InChI=1S/C20H17ClN2O5S/c1-2-27-14-6-4-13(5-7-14)22-20-23-19(26)17(29-20)10-12-3-8-16(15(21)9-12)28-11-18(24)25/h3-10H,2,11H2,1H3,(H,24,25)(H,22,23,26)/p-1/b17-10+ |
| InChIKey | UXTWOSPJPBMNJZ-LICLKQGHSA-M |
| XLogP | 2.76 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|