C19H16BrN3O3S — CID 135534005
2-[2-bromo-4-[[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 135534005) has the molecular formula C19H16BrN3O3S and a molecular weight of 446.33 g/mol. Its IUPAC name is 2-[2-bromo-4-[[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | 2-[2-bromo-4-[[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 135534005 |
| Molecular Formula | C19H16BrN3O3S |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 445.01 |
| IUPAC Name | 2-[2-bromo-4-[[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | Cc1ccc(/N=C2/NC(=O)C(=Cc3ccc(OCC(N)=O)c(Br)c3)S2)cc1 |
| InChI | InChI=1S/C19H16BrN3O3S/c1-11-2-5-13(6-3-11)22-19-23-18(25)16(27-19)9-12-4-7-15(14(20)8-12)26-10-17(21)24/h2-9H,10H2,1H3,(H2,21,24)(H,22,23,25) |
| InChIKey | FXBMCADGVHTZJX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|