C20H17IN2O4S — CID 137080883
methyl 2-[2-iodo-4-[(E)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 137080883) has the molecular formula C20H17IN2O4S and a molecular weight of 508.34 g/mol. Its IUPAC name is methyl 2-[2-iodo-4-[(E)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-iodo-4-[(E)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 137080883 |
| Molecular Formula | C20H17IN2O4S |
| Molecular Weight | 508.34 g/mol |
| Exact Mass | 508.00 |
| IUPAC Name | methyl 2-[2-iodo-4-[(E)-[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(/C=C2/S/C(=N\c3ccc(C)cc3)NC2=O)cc1I |
| InChI | InChI=1S/C20H17IN2O4S/c1-12-3-6-14(7-4-12)22-20-23-19(25)17(28-20)10-13-5-8-16(15(21)9-13)27-11-18(24)26-2/h3-10H,11H2,1-2H3,(H,22,23,25)/b17-10+ |
| InChIKey | YZIMMCYRXFSPAR-LICLKQGHSA-N |
| XLogP | 4.04 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|