C20H16FIN2O4S — CID 137024933
ethyl 2-[4-[(E)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]acetate (PubChem CID 137024933) has the molecular formula C20H16FIN2O4S and a molecular weight of 526.33 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]acetate.
| Compound Name | ethyl 2-[4-[(E)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]acetate |
|---|---|
| PubChem CID | 137024933 |
| Molecular Formula | C20H16FIN2O4S |
| Molecular Weight | 526.33 g/mol |
| Exact Mass | 525.99 |
| IUPAC Name | ethyl 2-[4-[(E)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(/C=C2/S/C(=N\c3ccc(F)cc3)NC2=O)cc1I |
| InChI | InChI=1S/C20H16FIN2O4S/c1-2-27-18(25)11-28-16-8-3-12(9-15(16)22)10-17-19(26)24-20(29-17)23-14-6-4-13(21)5-7-14/h3-10H,2,11H2,1H3,(H,23,24,26)/b17-10+ |
| InChIKey | UMLQSFKAFPGINC-LICLKQGHSA-N |
| XLogP | 4.26 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|