C19H15FN2O3S — CID 137166070
ethyl 4-[[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 137166070) has the molecular formula C19H15FN2O3S and a molecular weight of 370.41 g/mol. Its IUPAC name is ethyl 4-[[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 137166070 |
| Molecular Formula | C19H15FN2O3S |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | ethyl 4-[[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C2\NC(=O)/C(=C/c3ccc(F)cc3)S2)cc1 |
| InChI | InChI=1S/C19H15FN2O3S/c1-2-25-18(24)13-5-9-15(10-6-13)21-19-22-17(23)16(26-19)11-12-3-7-14(20)8-4-12/h3-11H,2H2,1H3,(H,21,22,23)/b16-11- |
| InChIKey | ATSMZZNEHBYTIH-WJDWOHSUSA-N |
| XLogP | 3.89 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|