C25H18Cl3N3O3S — CID 137074464
2-[2-chloro-4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3-chloro-4-methylphenyl)acetamide (PubChem CID 137074464) has the molecular formula C25H18Cl3N3O3S and a molecular weight of 546.86 g/mol. Its IUPAC name is 2-[2-chloro-4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3-chloro-4-methylphenyl)acetamide.
| Compound Name | 2-[2-chloro-4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3-chloro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 137074464 |
| Molecular Formula | C25H18Cl3N3O3S |
| Molecular Weight | 546.86 g/mol |
| Exact Mass | 545.01 |
| IUPAC Name | 2-[2-chloro-4-[(Z)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3-chloro-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(/C=C3\S/C(=N/c4ccc(Cl)cc4)NC3=O)cc2Cl)cc1Cl |
| InChI | InChI=1S/C25H18Cl3N3O3S/c1-14-2-6-18(12-19(14)27)29-23(32)13-34-21-9-3-15(10-20(21)28)11-22-24(33)31-25(35-22)30-17-7-4-16(26)5-8-17/h2-12H,13H2,1H3,(H,29,32)(H,30,31,33)/b22-11- |
| InChIKey | MZMGZJKXFZFRRW-JJFYIABZSA-N |
| XLogP | 6.86 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.86 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|