C24H15Cl4N3O3S — CID 137018103
2-[4-chloro-2-[(E)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3,4-dichlorophenyl)acetamide (PubChem CID 137018103) has the molecular formula C24H15Cl4N3O3S and a molecular weight of 567.28 g/mol. Its IUPAC name is 2-[4-chloro-2-[(E)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3,4-dichlorophenyl)acetamide.
| Compound Name | 2-[4-chloro-2-[(E)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 137018103 |
| Molecular Formula | C24H15Cl4N3O3S |
| Molecular Weight | 567.28 g/mol |
| Exact Mass | 564.96 |
| IUPAC Name | 2-[4-chloro-2-[(E)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3,4-dichlorophenyl)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1/C=C1/S/C(=N\c2ccc(Cl)cc2)NC1=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H15Cl4N3O3S/c25-14-1-4-16(5-2-14)30-24-31-23(33)21(35-24)10-13-9-15(26)3-8-20(13)34-12-22(32)29-17-6-7-18(27)19(28)11-17/h1-11H,12H2,(H,29,32)(H,30,31,33)/b21-10+ |
| InChIKey | VLPYYRQPEVOKPV-UFFVCSGVSA-N |
| XLogP | 7.21 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.28 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|