C25H20ClN3O3S — CID 135518432
2-[4-chloro-2-[(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 135518432) has the molecular formula C25H20ClN3O3S and a molecular weight of 477.97 g/mol. Its IUPAC name is 2-[4-chloro-2-[(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[4-chloro-2-[(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 135518432 |
| Molecular Formula | C25H20ClN3O3S |
| Molecular Weight | 477.97 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 2-[4-chloro-2-[(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)COc2ccc(Cl)cc2C=C2S/C(=N\c3ccccc3)NC2=O)c1 |
| InChI | InChI=1S/C25H20ClN3O3S/c1-16-6-5-9-20(12-16)27-23(30)15-32-21-11-10-18(26)13-17(21)14-22-24(31)29-25(33-22)28-19-7-3-2-4-8-19/h2-14H,15H2,1H3,(H,27,30)(H,28,29,31) |
| InChIKey | SKDCYQNDPZOQQT-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.97 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|