C24H17Cl2N3O3S — CID 137081151
2-[2-[(E)-[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-phenylacetamide (PubChem CID 137081151) has the molecular formula C24H17Cl2N3O3S and a molecular weight of 498.39 g/mol. Its IUPAC name is 2-[2-[(E)-[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-[(E)-[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 137081151 |
| Molecular Formula | C24H17Cl2N3O3S |
| Molecular Weight | 498.39 g/mol |
| Exact Mass | 497.04 |
| IUPAC Name | 2-[2-[(E)-[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-phenylacetamide |
| SMILES | O=C(COc1ccccc1/C=C1/S/C(=N\c2cccc(Cl)c2Cl)NC1=O)Nc1ccccc1 |
| InChI | InChI=1S/C24H17Cl2N3O3S/c25-17-10-6-11-18(22(17)26)28-24-29-23(31)20(33-24)13-15-7-4-5-12-19(15)32-14-21(30)27-16-8-2-1-3-9-16/h1-13H,14H2,(H,27,30)(H,28,29,31)/b20-13+ |
| InChIKey | QGZZURCIUWHXKA-DEDYPNTBSA-N |
| XLogP | 5.90 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.39 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|