C20H18N4O7S2 — CID 135844816
2-[[(5Z)-4-oxo-5-[[2-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]methylidene]-1,3-thiazolidin-2-ylidene]amino]acetic acid (PubChem CID 135844816) has the molecular formula C20H18N4O7S2 and a molecular weight of 490.52 g/mol. Its IUPAC name is 2-[[(5Z)-4-oxo-5-[[2-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]methylidene]-1,3-thiazolidin-2-ylidene]amino]acetic acid.
| Compound Name | 2-[[(5Z)-4-oxo-5-[[2-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]methylidene]-1,3-thiazolidin-2-ylidene]amino]acetic acid |
|---|---|
| PubChem CID | 135844816 |
| Molecular Formula | C20H18N4O7S2 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | 2-[[(5Z)-4-oxo-5-[[2-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]methylidene]-1,3-thiazolidin-2-ylidene]amino]acetic acid |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COc2ccccc2/C=C2\S/C(=N/CC(=O)O)NC2=O)cc1 |
| InChI | InChI=1S/C20H18N4O7S2/c21-33(29,30)14-7-5-13(6-8-14)23-17(25)11-31-15-4-2-1-3-12(15)9-16-19(28)24-20(32-16)22-10-18(26)27/h1-9H,10-11H2,(H,23,25)(H,26,27)(H2,21,29,30)(H,22,24,28)/b16-9- |
| InChIKey | FGZRFWTYCVEPDL-SXGWCWSVSA-N |
| XLogP | 1.00 |
| TPSA | 177.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|