C18H15N3O6S2 — CID 16634206
2-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 16634206) has the molecular formula C18H15N3O6S2 and a molecular weight of 433.47 g/mol. Its IUPAC name is 2-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 16634206 |
| Molecular Formula | C18H15N3O6S2 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | 2-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COc2ccccc2/C=C2\SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C18H15N3O6S2/c19-29(25,26)13-7-5-12(6-8-13)20-16(22)10-27-14-4-2-1-3-11(14)9-15-17(23)21-18(24)28-15/h1-9H,10H2,(H,20,22)(H2,19,25,26)(H,21,23,24)/b15-9- |
| InChIKey | CTEHOCVTXUTHPJ-DHDCSXOGSA-N |
| XLogP | 1.68 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|