C28H23N5O6S3 — CID 16627911
2-[2-[(Z)-[(2Z)-3-(furan-2-ylmethyl)-4-oxo-2-[(E)-thiophen-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 16627911) has the molecular formula C28H23N5O6S3 and a molecular weight of 621.72 g/mol. Its IUPAC name is 2-[2-[(Z)-[(2Z)-3-(furan-2-ylmethyl)-4-oxo-2-[(E)-thiophen-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[2-[(Z)-[(2Z)-3-(furan-2-ylmethyl)-4-oxo-2-[(E)-thiophen-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 16627911 |
| Molecular Formula | C28H23N5O6S3 |
| Molecular Weight | 621.72 g/mol |
| Exact Mass | 621.08 |
| IUPAC Name | 2-[2-[(Z)-[(2Z)-3-(furan-2-ylmethyl)-4-oxo-2-[(E)-thiophen-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COc2ccccc2/C=C2\S/C(=N\N=C\c3cccs3)N(Cc3ccco3)C2=O)cc1 |
| InChI | InChI=1S/C28H23N5O6S3/c29-42(36,37)23-11-9-20(10-12-23)31-26(34)18-39-24-8-2-1-5-19(24)15-25-27(35)33(17-21-6-3-13-38-21)28(41-25)32-30-16-22-7-4-14-40-22/h1-16H,17-18H2,(H,31,34)(H2,29,36,37)/b25-15-,30-16+,32-28- |
| InChIKey | DYKSLYFWXVYLPW-NPUFHZIESA-N |
| XLogP | 4.51 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.72 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|