C28H20Cl2N4O4S2 — CID 16627912
2-[4-chloro-2-[(Z)-[(2Z)-3-(furan-2-ylmethyl)-4-oxo-2-[(E)-thiophen-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide (PubChem CID 16627912) has the molecular formula C28H20Cl2N4O4S2 and a molecular weight of 611.53 g/mol. Its IUPAC name is 2-[4-chloro-2-[(Z)-[(2Z)-3-(furan-2-ylmethyl)-4-oxo-2-[(E)-thiophen-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[4-chloro-2-[(Z)-[(2Z)-3-(furan-2-ylmethyl)-4-oxo-2-[(E)-thiophen-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 16627912 |
| Molecular Formula | C28H20Cl2N4O4S2 |
| Molecular Weight | 611.53 g/mol |
| Exact Mass | 610.03 |
| IUPAC Name | 2-[4-chloro-2-[(Z)-[(2Z)-3-(furan-2-ylmethyl)-4-oxo-2-[(E)-thiophen-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1/C=C1\S/C(=N\N=C\c2cccs2)N(Cc2ccco2)C1=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H20Cl2N4O4S2/c29-19-5-8-21(9-6-19)32-26(35)17-38-24-10-7-20(30)13-18(24)14-25-27(36)34(16-22-3-1-11-37-22)28(40-25)33-31-15-23-4-2-12-39-23/h1-15H,16-17H2,(H,32,35)/b25-14-,31-15+,33-28- |
| InChIKey | IVYKJTDAUYBQIF-PMZKJNBCSA-N |
| XLogP | 7.17 |
| TPSA | 96.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.53 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|