C36H26ClFN4O4S — CID 19246717
2-[4-chloro-2-[(Z)-[(2E)-3-(furan-2-ylmethyl)-4-oxo-2-[(Z)-(4-phenylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 19246717) has the molecular formula C36H26ClFN4O4S and a molecular weight of 665.15 g/mol. Its IUPAC name is 2-[4-chloro-2-[(Z)-[(2E)-3-(furan-2-ylmethyl)-4-oxo-2-[(Z)-(4-phenylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[4-chloro-2-[(Z)-[(2E)-3-(furan-2-ylmethyl)-4-oxo-2-[(Z)-(4-phenylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 19246717 |
| Molecular Formula | C36H26ClFN4O4S |
| Molecular Weight | 665.15 g/mol |
| Exact Mass | 664.13 |
| IUPAC Name | 2-[4-chloro-2-[(Z)-[(2E)-3-(furan-2-ylmethyl)-4-oxo-2-[(Z)-(4-phenylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1/C=C1\S/C(=N/N=C\c2ccc(-c3ccccc3)cc2)N(Cc2ccco2)C1=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C36H26ClFN4O4S/c37-28-12-17-32(46-23-34(43)40-30-15-13-29(38)14-16-30)27(19-28)20-33-35(44)42(22-31-7-4-18-45-31)36(47-33)41-39-21-24-8-10-26(11-9-24)25-5-2-1-3-6-25/h1-21H,22-23H2,(H,40,43)/b33-20-,39-21-,41-36+ |
| InChIKey | YLDQWILYVOFMPE-IJMGYKIUSA-N |
| XLogP | 8.26 |
| TPSA | 96.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.15 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|