C32H28ClN5O4S — CID 16628764
N-(4-chlorophenyl)-2-[2-[(Z)-[(2Z)-2-[(E)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 16628764) has the molecular formula C32H28ClN5O4S and a molecular weight of 614.13 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[2-[(Z)-[(2Z)-2-[(E)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[2-[(Z)-[(2Z)-2-[(E)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 16628764 |
| Molecular Formula | C32H28ClN5O4S |
| Molecular Weight | 614.13 g/mol |
| Exact Mass | 613.16 |
| IUPAC Name | N-(4-chlorophenyl)-2-[2-[(Z)-[(2Z)-2-[(E)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | CN(C)c1ccc(/C=N/N=C2\S/C(=C\c3ccccc3OCC(=O)Nc3ccc(Cl)cc3)C(=O)N2Cc2ccco2)cc1 |
| InChI | InChI=1S/C32H28ClN5O4S/c1-37(2)26-15-9-22(10-16-26)19-34-36-32-38(20-27-7-5-17-41-27)31(40)29(43-32)18-23-6-3-4-8-28(23)42-21-30(39)35-25-13-11-24(33)12-14-25/h3-19H,20-21H2,1-2H3,(H,35,39)/b29-18-,34-19+,36-32- |
| InChIKey | NIQWXQVLRWEIJZ-FWIAKMNFSA-N |
| XLogP | 6.52 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.13 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|