C31H25BrN4O4S — CID 19246582
2-[2-[(Z)-[(2E)-2-[(Z)-(4-bromophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 19246582) has the molecular formula C31H25BrN4O4S and a molecular weight of 629.54 g/mol. Its IUPAC name is 2-[2-[(Z)-[(2E)-2-[(Z)-(4-bromophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-[(Z)-[(2E)-2-[(Z)-(4-bromophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 19246582 |
| Molecular Formula | C31H25BrN4O4S |
| Molecular Weight | 629.54 g/mol |
| Exact Mass | 628.08 |
| IUPAC Name | 2-[2-[(Z)-[(2E)-2-[(Z)-(4-bromophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccccc2/C=C2\S/C(=N/N=C\c3ccc(Br)cc3)N(Cc3ccco3)C2=O)cc1 |
| InChI | InChI=1S/C31H25BrN4O4S/c1-21-8-14-25(15-9-21)34-29(37)20-40-27-7-3-2-5-23(27)17-28-30(38)36(19-26-6-4-16-39-26)31(41-28)35-33-18-22-10-12-24(32)13-11-22/h2-18H,19-20H2,1H3,(H,34,37)/b28-17-,33-18-,35-31+ |
| InChIKey | CMPPSNRIVTXKOL-VIMBVUJASA-N |
| XLogP | 6.87 |
| TPSA | 96.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.54 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|