C31H23BrCl2N4O4S — CID 19246502
2-[4-bromo-2-[(Z)-[(2E)-2-[(Z)-(2,3-dichlorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 19246502) has the molecular formula C31H23BrCl2N4O4S and a molecular weight of 698.43 g/mol. Its IUPAC name is 2-[4-bromo-2-[(Z)-[(2E)-2-[(Z)-(2,3-dichlorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-bromo-2-[(Z)-[(2E)-2-[(Z)-(2,3-dichlorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 19246502 |
| Molecular Formula | C31H23BrCl2N4O4S |
| Molecular Weight | 698.43 g/mol |
| Exact Mass | 696.00 |
| IUPAC Name | 2-[4-bromo-2-[(Z)-[(2E)-2-[(Z)-(2,3-dichlorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(Br)cc2/C=C2\S/C(=N/N=C\c3cccc(Cl)c3Cl)N(Cc3ccco3)C2=O)cc1 |
| InChI | InChI=1S/C31H23BrCl2N4O4S/c1-19-7-10-23(11-8-19)36-28(39)18-42-26-12-9-22(32)14-21(26)15-27-30(40)38(17-24-5-3-13-41-24)31(43-27)37-35-16-20-4-2-6-25(33)29(20)34/h2-16H,17-18H2,1H3,(H,36,39)/b27-15-,35-16-,37-31+ |
| InChIKey | OOHBKULAJVDKTR-KXMUEAMBSA-N |
| XLogP | 8.18 |
| TPSA | 96.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.43 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|