C30H21BrClN5O6S — CID 19247029
2-[4-bromo-2-[(Z)-[(2E)-3-(furan-2-ylmethyl)-2-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide (PubChem CID 19247029) has the molecular formula C30H21BrClN5O6S and a molecular weight of 694.95 g/mol. Its IUPAC name is 2-[4-bromo-2-[(Z)-[(2E)-3-(furan-2-ylmethyl)-2-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[4-bromo-2-[(Z)-[(2E)-3-(furan-2-ylmethyl)-2-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 19247029 |
| Molecular Formula | C30H21BrClN5O6S |
| Molecular Weight | 694.95 g/mol |
| Exact Mass | 693.01 |
| IUPAC Name | 2-[4-bromo-2-[(Z)-[(2E)-3-(furan-2-ylmethyl)-2-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide |
| SMILES | O=C(COc1ccc(Br)cc1/C=C1\S/C(=N/N=C\c2ccc([N+](=O)[O-])cc2)N(Cc2ccco2)C1=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H21BrClN5O6S/c31-21-5-12-26(43-18-28(38)34-23-8-6-22(32)7-9-23)20(14-21)15-27-29(39)36(17-25-2-1-13-42-25)30(44-27)35-33-16-19-3-10-24(11-4-19)37(40)41/h1-16H,17-18H2,(H,34,38)/b27-15-,33-16-,35-30+ |
| InChIKey | FYYYCYBOWOLBLX-FCWMMYJYSA-N |
| XLogP | 7.13 |
| TPSA | 139.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.95 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|