C31H25N5O6S — CID 19246978
2-[2-[(Z)-[(2E)-3-(furan-2-ylmethyl)-2-[(Z)-(3-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 19246978) has the molecular formula C31H25N5O6S and a molecular weight of 595.64 g/mol. Its IUPAC name is 2-[2-[(Z)-[(2E)-3-(furan-2-ylmethyl)-2-[(Z)-(3-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-[(Z)-[(2E)-3-(furan-2-ylmethyl)-2-[(Z)-(3-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 19246978 |
| Molecular Formula | C31H25N5O6S |
| Molecular Weight | 595.64 g/mol |
| Exact Mass | 595.15 |
| IUPAC Name | 2-[2-[(Z)-[(2E)-3-(furan-2-ylmethyl)-2-[(Z)-(3-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccccc2/C=C2\S/C(=N/N=C\c3cccc([N+](=O)[O-])c3)N(Cc3ccco3)C2=O)cc1 |
| InChI | InChI=1S/C31H25N5O6S/c1-21-11-13-24(14-12-21)33-29(37)20-42-27-10-3-2-7-23(27)17-28-30(38)35(19-26-9-5-15-41-26)31(43-28)34-32-18-22-6-4-8-25(16-22)36(39)40/h2-18H,19-20H2,1H3,(H,33,37)/b28-17-,32-18-,34-31+ |
| InChIKey | CDYADVNYRDYMDH-BIKPRRIHSA-N |
| XLogP | 6.02 |
| TPSA | 139.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.64 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|