C32H27FN4O6S — CID 135732429
2-[2-[(Z)-[(2Z)-2-[(E)-(3-ethoxy-4-hydroxyphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 135732429) has the molecular formula C32H27FN4O6S and a molecular weight of 614.66 g/mol. Its IUPAC name is 2-[2-[(Z)-[(2Z)-2-[(E)-(3-ethoxy-4-hydroxyphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[2-[(Z)-[(2Z)-2-[(E)-(3-ethoxy-4-hydroxyphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 135732429 |
| Molecular Formula | C32H27FN4O6S |
| Molecular Weight | 614.66 g/mol |
| Exact Mass | 614.16 |
| IUPAC Name | 2-[2-[(Z)-[(2Z)-2-[(E)-(3-ethoxy-4-hydroxyphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | CCOc1cc(/C=N/N=C2\S/C(=C\c3ccccc3OCC(=O)Nc3ccc(F)cc3)C(=O)N2Cc2ccco2)ccc1O |
| InChI | InChI=1S/C32H27FN4O6S/c1-2-41-28-16-21(9-14-26(28)38)18-34-36-32-37(19-25-7-5-15-42-25)31(40)29(44-32)17-22-6-3-4-8-27(22)43-20-30(39)35-24-12-10-23(33)11-13-24/h3-18,38H,2,19-20H2,1H3,(H,35,39)/b29-17-,34-18+,36-32- |
| InChIKey | QYMBEWFWSKIASR-MUTJXNGASA-N |
| XLogP | 6.05 |
| TPSA | 125.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.66 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|