C30H22ClFN4O5S — CID 135773058
2-[2-[(Z)-[(2E)-2-[(Z)-(5-chloro-2-hydroxyphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 135773058) has the molecular formula C30H22ClFN4O5S and a molecular weight of 605.05 g/mol. Its IUPAC name is 2-[2-[(Z)-[(2E)-2-[(Z)-(5-chloro-2-hydroxyphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[2-[(Z)-[(2E)-2-[(Z)-(5-chloro-2-hydroxyphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 135773058 |
| Molecular Formula | C30H22ClFN4O5S |
| Molecular Weight | 605.05 g/mol |
| Exact Mass | 604.10 |
| IUPAC Name | 2-[2-[(Z)-[(2E)-2-[(Z)-(5-chloro-2-hydroxyphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(COc1ccccc1/C=C1\S/C(=N/N=C\c2cc(Cl)ccc2O)N(Cc2ccco2)C1=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C30H22ClFN4O5S/c31-21-7-12-25(37)20(14-21)16-33-35-30-36(17-24-5-3-13-40-24)29(39)27(42-30)15-19-4-1-2-6-26(19)41-18-28(38)34-23-10-8-22(32)9-11-23/h1-16,37H,17-18H2,(H,34,38)/b27-15-,33-16-,35-30+ |
| InChIKey | RVTZCKSQGQCXQX-FCWMMYJYSA-N |
| XLogP | 6.30 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.05 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|