C30H24FN5O6S2 — CID 16628557
2-[2-[(Z)-[(2Z)-2-[(E)-(2-fluorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 16628557) has the molecular formula C30H24FN5O6S2 and a molecular weight of 633.68 g/mol. Its IUPAC name is 2-[2-[(Z)-[(2Z)-2-[(E)-(2-fluorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[2-[(Z)-[(2Z)-2-[(E)-(2-fluorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 16628557 |
| Molecular Formula | C30H24FN5O6S2 |
| Molecular Weight | 633.68 g/mol |
| Exact Mass | 633.12 |
| IUPAC Name | 2-[2-[(Z)-[(2Z)-2-[(E)-(2-fluorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COc2ccccc2/C=C2\S/C(=N\N=C\c3ccccc3F)N(Cc3ccco3)C2=O)cc1 |
| InChI | InChI=1S/C30H24FN5O6S2/c31-25-9-3-1-7-21(25)17-33-35-30-36(18-23-8-5-15-41-23)29(38)27(43-30)16-20-6-2-4-10-26(20)42-19-28(37)34-22-11-13-24(14-12-22)44(32,39)40/h1-17H,18-19H2,(H,34,37)(H2,32,39,40)/b27-16-,33-17+,35-30- |
| InChIKey | BJPPUMUGKBRTER-XCGHRQKYSA-N |
| XLogP | 4.59 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.68 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|