C29H23ClN6O6S2 — CID 19246147
2-[4-chloro-2-[(Z)-[(2E)-3-(furan-2-ylmethyl)-4-oxo-2-[(Z)-pyridin-3-ylmethylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 19246147) has the molecular formula C29H23ClN6O6S2 and a molecular weight of 651.13 g/mol. Its IUPAC name is 2-[4-chloro-2-[(Z)-[(2E)-3-(furan-2-ylmethyl)-4-oxo-2-[(Z)-pyridin-3-ylmethylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[4-chloro-2-[(Z)-[(2E)-3-(furan-2-ylmethyl)-4-oxo-2-[(Z)-pyridin-3-ylmethylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 19246147 |
| Molecular Formula | C29H23ClN6O6S2 |
| Molecular Weight | 651.13 g/mol |
| Exact Mass | 650.08 |
| IUPAC Name | 2-[4-chloro-2-[(Z)-[(2E)-3-(furan-2-ylmethyl)-4-oxo-2-[(Z)-pyridin-3-ylmethylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COc2ccc(Cl)cc2/C=C2\S/C(=N/N=C\c3cccnc3)N(Cc3ccco3)C2=O)cc1 |
| InChI | InChI=1S/C29H23ClN6O6S2/c30-21-5-10-25(42-18-27(37)34-22-6-8-24(9-7-22)44(31,39)40)20(13-21)14-26-28(38)36(17-23-4-2-12-41-23)29(43-26)35-33-16-19-3-1-11-32-15-19/h1-16H,17-18H2,(H,34,37)(H2,31,39,40)/b26-14-,33-16-,35-29+ |
| InChIKey | JFTXMOANEPODBH-MIWBNDGESA-N |
| XLogP | 4.50 |
| TPSA | 169.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.13 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|