C29H21Cl2N5O4S — CID 16627780
2-[4-chloro-2-[(Z)-[(2Z)-3-(furan-2-ylmethyl)-4-oxo-2-[(E)-pyridin-3-ylmethylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide (PubChem CID 16627780) has the molecular formula C29H21Cl2N5O4S and a molecular weight of 606.49 g/mol. Its IUPAC name is 2-[4-chloro-2-[(Z)-[(2Z)-3-(furan-2-ylmethyl)-4-oxo-2-[(E)-pyridin-3-ylmethylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[4-chloro-2-[(Z)-[(2Z)-3-(furan-2-ylmethyl)-4-oxo-2-[(E)-pyridin-3-ylmethylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 16627780 |
| Molecular Formula | C29H21Cl2N5O4S |
| Molecular Weight | 606.49 g/mol |
| Exact Mass | 605.07 |
| IUPAC Name | 2-[4-chloro-2-[(Z)-[(2Z)-3-(furan-2-ylmethyl)-4-oxo-2-[(E)-pyridin-3-ylmethylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1/C=C1\S/C(=N\N=C\c2cccnc2)N(Cc2ccco2)C1=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H21Cl2N5O4S/c30-21-5-8-23(9-6-21)34-27(37)18-40-25-10-7-22(31)13-20(25)14-26-28(38)36(17-24-4-2-12-39-24)29(41-26)35-33-16-19-3-1-11-32-15-19/h1-16H,17-18H2,(H,34,37)/b26-14-,33-16+,35-29- |
| InChIKey | XLUBBALLQGOGSB-RQVHSTPDSA-N |
| XLogP | 6.51 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.49 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|