C31H25ClN4O5S — CID 19246624
N-(4-chlorophenyl)-2-[2-[(Z)-[(2E)-3-(furan-2-ylmethyl)-2-[(Z)-(2-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 19246624) has the molecular formula C31H25ClN4O5S and a molecular weight of 601.08 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[2-[(Z)-[(2E)-3-(furan-2-ylmethyl)-2-[(Z)-(2-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[2-[(Z)-[(2E)-3-(furan-2-ylmethyl)-2-[(Z)-(2-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 19246624 |
| Molecular Formula | C31H25ClN4O5S |
| Molecular Weight | 601.08 g/mol |
| Exact Mass | 600.12 |
| IUPAC Name | N-(4-chlorophenyl)-2-[2-[(Z)-[(2E)-3-(furan-2-ylmethyl)-2-[(Z)-(2-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | COc1ccccc1/C=N\N=C1\S/C(=C\c2ccccc2OCC(=O)Nc2ccc(Cl)cc2)C(=O)N1Cc1ccco1 |
| InChI | InChI=1S/C31H25ClN4O5S/c1-39-26-10-4-3-8-22(26)18-33-35-31-36(19-25-9-6-16-40-25)30(38)28(42-31)17-21-7-2-5-11-27(21)41-20-29(37)34-24-14-12-23(32)13-15-24/h2-18H,19-20H2,1H3,(H,34,37)/b28-17-,33-18-,35-31+ |
| InChIKey | KYUZVWCBRQAXSK-VIMBVUJASA-N |
| XLogP | 6.47 |
| TPSA | 105.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.08 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|