C35H34N4O4S — CID 16627734
2-[2-[(Z)-[(2Z)-2-[(E)-(4-tert-butylphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 16627734) has the molecular formula C35H34N4O4S and a molecular weight of 606.75 g/mol. Its IUPAC name is 2-[2-[(Z)-[(2Z)-2-[(E)-(4-tert-butylphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-[(Z)-[(2Z)-2-[(E)-(4-tert-butylphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 16627734 |
| Molecular Formula | C35H34N4O4S |
| Molecular Weight | 606.75 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | 2-[2-[(Z)-[(2Z)-2-[(E)-(4-tert-butylphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccccc2/C=C2\S/C(=N\N=C\c3ccc(C(C)(C)C)cc3)N(Cc3ccco3)C2=O)cc1 |
| InChI | InChI=1S/C35H34N4O4S/c1-24-11-17-28(18-12-24)37-32(40)23-43-30-10-6-5-8-26(30)20-31-33(41)39(22-29-9-7-19-42-29)34(44-31)38-36-21-25-13-15-27(16-14-25)35(2,3)4/h5-21H,22-23H2,1-4H3,(H,37,40)/b31-20-,36-21+,38-34- |
| InChIKey | BAWVRGMVAGXQAP-PGEWJVJYSA-N |
| XLogP | 7.41 |
| TPSA | 96.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.75 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|