C25H24N4O3S — CID 16628752
(2Z,5Z)-2-[(E)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(2-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 16628752) has the molecular formula C25H24N4O3S and a molecular weight of 460.56 g/mol. Its IUPAC name is (2Z,5Z)-2-[(E)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(2-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5Z)-2-[(E)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(2-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16628752 |
| Molecular Formula | C25H24N4O3S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | (2Z,5Z)-2-[(E)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(2-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccccc1/C=C1\S/C(=N\N=C\c2ccc(N(C)C)cc2)N(Cc2ccco2)C1=O |
| InChI | InChI=1S/C25H24N4O3S/c1-28(2)20-12-10-18(11-13-20)16-26-27-25-29(17-21-8-6-14-32-21)24(30)23(33-25)15-19-7-4-5-9-22(19)31-3/h4-16H,17H2,1-3H3/b23-15-,26-16+,27-25- |
| InChIKey | DEXVCRVXLIZJOX-HXWXGCPYSA-N |
| XLogP | 4.86 |
| TPSA | 70.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|