C27H26N4O2S — CID 16628758
(2Z,5Z)-2-[(E)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one (PubChem CID 16628758) has the molecular formula C27H26N4O2S and a molecular weight of 470.60 g/mol. Its IUPAC name is (2Z,5Z)-2-[(E)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5Z)-2-[(E)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16628758 |
| Molecular Formula | C27H26N4O2S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | (2Z,5Z)-2-[(E)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one |
| SMILES | CC(/C=C1\S/C(=N\N=C\c2ccc(N(C)C)cc2)N(Cc2ccco2)C1=O)=C\c1ccccc1 |
| InChI | InChI=1S/C27H26N4O2S/c1-20(16-21-8-5-4-6-9-21)17-25-26(32)31(19-24-10-7-15-33-24)27(34-25)29-28-18-22-11-13-23(14-12-22)30(2)3/h4-18H,19H2,1-3H3/b20-16+,25-17-,28-18+,29-27- |
| InChIKey | LZEWBCKDPHJBMJ-QUJAOYQXSA-N |
| XLogP | 5.80 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|