C25H20FN3O2S — CID 19246881
(2E,5Z)-5-[(2-fluorophenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-[(E)-2-methyl-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 19246881) has the molecular formula C25H20FN3O2S and a molecular weight of 445.52 g/mol. Its IUPAC name is (2E,5Z)-5-[(2-fluorophenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-[(E)-2-methyl-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[(2-fluorophenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-[(E)-2-methyl-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 19246881 |
| Molecular Formula | C25H20FN3O2S |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | (2E,5Z)-5-[(2-fluorophenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-[(E)-2-methyl-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CC(/C=N\N=C1\S/C(=C\c2ccccc2F)C(=O)N1Cc1ccco1)=C\c1ccccc1 |
| InChI | InChI=1S/C25H20FN3O2S/c1-18(14-19-8-3-2-4-9-19)16-27-28-25-29(17-21-11-7-13-31-21)24(30)23(32-25)15-20-10-5-6-12-22(20)26/h2-16H,17H2,1H3/b18-14+,23-15-,27-16-,28-25+ |
| InChIKey | LUQPNGUDHMEXCB-MLUFDKFPSA-N |
| XLogP | 5.98 |
| TPSA | 58.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|