C31H25N3O3S — CID 19246869
(2E,5Z)-3-(furan-2-ylmethyl)-2-[(Z)-[(E)-2-methyl-3-phenylprop-2-enylidene]hydrazinylidene]-5-[(3-phenoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 19246869) has the molecular formula C31H25N3O3S and a molecular weight of 519.63 g/mol. Its IUPAC name is (2E,5Z)-3-(furan-2-ylmethyl)-2-[(Z)-[(E)-2-methyl-3-phenylprop-2-enylidene]hydrazinylidene]-5-[(3-phenoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-3-(furan-2-ylmethyl)-2-[(Z)-[(E)-2-methyl-3-phenylprop-2-enylidene]hydrazinylidene]-5-[(3-phenoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 19246869 |
| Molecular Formula | C31H25N3O3S |
| Molecular Weight | 519.63 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | (2E,5Z)-3-(furan-2-ylmethyl)-2-[(Z)-[(E)-2-methyl-3-phenylprop-2-enylidene]hydrazinylidene]-5-[(3-phenoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CC(/C=N\N=C1\S/C(=C\c2cccc(Oc3ccccc3)c2)C(=O)N1Cc1ccco1)=C\c1ccccc1 |
| InChI | InChI=1S/C31H25N3O3S/c1-23(18-24-10-4-2-5-11-24)21-32-33-31-34(22-28-16-9-17-36-28)30(35)29(38-31)20-25-12-8-15-27(19-25)37-26-13-6-3-7-14-26/h2-21H,22H2,1H3/b23-18+,29-20-,32-21-,33-31+ |
| InChIKey | NBRYQJMFOLVFQK-ZXNJBDGISA-N |
| XLogP | 7.63 |
| TPSA | 67.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.63 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|