C28H19Br2N3O4S — CID 19246402
(2E,5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-(3-phenoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 19246402) has the molecular formula C28H19Br2N3O4S and a molecular weight of 653.35 g/mol. Its IUPAC name is (2E,5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-(3-phenoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-(3-phenoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 19246402 |
| Molecular Formula | C28H19Br2N3O4S |
| Molecular Weight | 653.35 g/mol |
| Exact Mass | 650.95 |
| IUPAC Name | (2E,5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-(3-phenoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cc(Br)cc(Br)c2O)S/C(=N/N=C\c2cccc(Oc3ccccc3)c2)N1Cc1ccco1 |
| InChI | InChI=1S/C28H19Br2N3O4S/c29-20-13-19(26(34)24(30)15-20)14-25-27(35)33(17-23-10-5-11-36-23)28(38-25)32-31-16-18-6-4-9-22(12-18)37-21-7-2-1-3-8-21/h1-16,34H,17H2/b25-14-,31-16-,32-28+ |
| InChIKey | BORLJGOHUGMHCT-SMOKGVOFSA-N |
| XLogP | 7.81 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.35 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|