C22H14Br2FN3O3S — CID 16627862
(2Z,5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-2-[(E)-(4-fluorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one (PubChem CID 16627862) has the molecular formula C22H14Br2FN3O3S and a molecular weight of 579.25 g/mol. Its IUPAC name is (2Z,5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-2-[(E)-(4-fluorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-2-[(E)-(4-fluorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16627862 |
| Molecular Formula | C22H14Br2FN3O3S |
| Molecular Weight | 579.25 g/mol |
| Exact Mass | 576.91 |
| IUPAC Name | (2Z,5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-2-[(E)-(4-fluorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cc(Br)cc(Br)c2O)S/C(=N\N=C\c2ccc(F)cc2)N1Cc1ccco1 |
| InChI | InChI=1S/C22H14Br2FN3O3S/c23-15-8-14(20(29)18(24)10-15)9-19-21(30)28(12-17-2-1-7-31-17)22(32-19)27-26-11-13-3-5-16(25)6-4-13/h1-11,29H,12H2/b19-9-,26-11+,27-22- |
| InChIKey | CRSQXNUCWLUUHX-XBJGBTMFSA-N |
| XLogP | 6.16 |
| TPSA | 78.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.25 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|