C28H20FN3O2S — CID 16627852
(2Z,5Z)-2-[(E)-(4-fluorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 16627852) has the molecular formula C28H20FN3O2S and a molecular weight of 481.55 g/mol. Its IUPAC name is (2Z,5Z)-2-[(E)-(4-fluorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5Z)-2-[(E)-(4-fluorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16627852 |
| Molecular Formula | C28H20FN3O2S |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | (2Z,5Z)-2-[(E)-(4-fluorophenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(-c3ccccc3)cc2)S/C(=N\N=C\c2ccc(F)cc2)N1Cc1ccco1 |
| InChI | InChI=1S/C28H20FN3O2S/c29-24-14-10-21(11-15-24)18-30-31-28-32(19-25-7-4-16-34-25)27(33)26(35-28)17-20-8-12-23(13-9-20)22-5-2-1-3-6-22/h1-18H,19H2/b26-17-,30-18+,31-28- |
| InChIKey | QICGEGIYPBMJNA-RCZXBRRHSA-N |
| XLogP | 6.59 |
| TPSA | 58.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|