C29H23N3O2S — CID 16628372
(2Z,5Z)-3-(furan-2-ylmethyl)-2-[(E)-(2-methylphenyl)methylidenehydrazinylidene]-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 16628372) has the molecular formula C29H23N3O2S and a molecular weight of 477.59 g/mol. Its IUPAC name is (2Z,5Z)-3-(furan-2-ylmethyl)-2-[(E)-(2-methylphenyl)methylidenehydrazinylidene]-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5Z)-3-(furan-2-ylmethyl)-2-[(E)-(2-methylphenyl)methylidenehydrazinylidene]-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16628372 |
| Molecular Formula | C29H23N3O2S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | (2Z,5Z)-3-(furan-2-ylmethyl)-2-[(E)-(2-methylphenyl)methylidenehydrazinylidene]-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccccc1/C=N/N=C1\S/C(=C\c2ccc(-c3ccccc3)cc2)C(=O)N1Cc1ccco1 |
| InChI | InChI=1S/C29H23N3O2S/c1-21-8-5-6-11-25(21)19-30-31-29-32(20-26-12-7-17-34-26)28(33)27(35-29)18-22-13-15-24(16-14-22)23-9-3-2-4-10-23/h2-19H,20H2,1H3/b27-18-,30-19+,31-29- |
| InChIKey | MTNFRJHHKLTILE-QUYHKLJJSA-N |
| XLogP | 6.76 |
| TPSA | 58.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|