C22H15Br2N3O3S — CID 135732608
(2Z,5Z)-5-benzylidene-2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one (PubChem CID 135732608) has the molecular formula C22H15Br2N3O3S and a molecular weight of 561.26 g/mol. Its IUPAC name is (2Z,5Z)-5-benzylidene-2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5Z)-5-benzylidene-2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135732608 |
| Molecular Formula | C22H15Br2N3O3S |
| Molecular Weight | 561.26 g/mol |
| Exact Mass | 558.92 |
| IUPAC Name | (2Z,5Z)-5-benzylidene-2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccccc2)S/C(=N\N=C\c2cc(Br)cc(Br)c2O)N1Cc1ccco1 |
| InChI | InChI=1S/C22H15Br2N3O3S/c23-16-10-15(20(28)18(24)11-16)12-25-26-22-27(13-17-7-4-8-30-17)21(29)19(31-22)9-14-5-2-1-3-6-14/h1-12,28H,13H2/b19-9-,25-12+,26-22- |
| InChIKey | SBOROGTVYJOWOY-MFZFQSLKSA-N |
| XLogP | 6.02 |
| TPSA | 78.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.26 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|