C27H25Br2N3O5S — CID 19246798
(2E,5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-[3-methoxy-4-(2-methylpropoxy)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 19246798) has the molecular formula C27H25Br2N3O5S and a molecular weight of 663.39 g/mol. Its IUPAC name is (2E,5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-[3-methoxy-4-(2-methylpropoxy)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-[3-methoxy-4-(2-methylpropoxy)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 19246798 |
| Molecular Formula | C27H25Br2N3O5S |
| Molecular Weight | 663.39 g/mol |
| Exact Mass | 660.99 |
| IUPAC Name | (2E,5Z)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-[3-methoxy-4-(2-methylpropoxy)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=N\N=C2\S/C(=C\c3cc(Br)cc(Br)c3O)C(=O)N2Cc2ccco2)ccc1OCC(C)C |
| InChI | InChI=1S/C27H25Br2N3O5S/c1-16(2)15-37-22-7-6-17(9-23(22)35-3)13-30-31-27-32(14-20-5-4-8-36-20)26(34)24(38-27)11-18-10-19(28)12-21(29)25(18)33/h4-13,16,33H,14-15H2,1-3H3/b24-11-,30-13-,31-27+ |
| InChIKey | WPPFNQFRHNPYAC-WBKLYMOTSA-N |
| XLogP | 7.06 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.39 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|