C27H26FN3O4S — CID 19246777
(2E,5Z)-5-[(4-fluorophenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-[3-methoxy-4-(2-methylpropoxy)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 19246777) has the molecular formula C27H26FN3O4S and a molecular weight of 507.59 g/mol. Its IUPAC name is (2E,5Z)-5-[(4-fluorophenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-[3-methoxy-4-(2-methylpropoxy)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[(4-fluorophenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-[3-methoxy-4-(2-methylpropoxy)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 19246777 |
| Molecular Formula | C27H26FN3O4S |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | (2E,5Z)-5-[(4-fluorophenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(Z)-[3-methoxy-4-(2-methylpropoxy)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=N\N=C2\S/C(=C\c3ccc(F)cc3)C(=O)N2Cc2ccco2)ccc1OCC(C)C |
| InChI | InChI=1S/C27H26FN3O4S/c1-18(2)17-35-23-11-8-20(13-24(23)33-3)15-29-30-27-31(16-22-5-4-12-34-22)26(32)25(36-27)14-19-6-9-21(28)10-7-19/h4-15,18H,16-17H2,1-3H3/b25-14-,29-15-,30-27+ |
| InChIKey | WSCKGSMBBPJCBA-UPJLPIFUSA-N |
| XLogP | 5.97 |
| TPSA | 76.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|