C34H33N3O5S — CID 16628408
(2Z,5Z)-3-(furan-2-ylmethyl)-2-[(E)-[3-methoxy-4-(2-methylpropoxy)phenyl]methylidenehydrazinylidene]-5-[(3-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 16628408) has the molecular formula C34H33N3O5S and a molecular weight of 595.72 g/mol. Its IUPAC name is (2Z,5Z)-3-(furan-2-ylmethyl)-2-[(E)-[3-methoxy-4-(2-methylpropoxy)phenyl]methylidenehydrazinylidene]-5-[(3-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5Z)-3-(furan-2-ylmethyl)-2-[(E)-[3-methoxy-4-(2-methylpropoxy)phenyl]methylidenehydrazinylidene]-5-[(3-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16628408 |
| Molecular Formula | C34H33N3O5S |
| Molecular Weight | 595.72 g/mol |
| Exact Mass | 595.21 |
| IUPAC Name | (2Z,5Z)-3-(furan-2-ylmethyl)-2-[(E)-[3-methoxy-4-(2-methylpropoxy)phenyl]methylidenehydrazinylidene]-5-[(3-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=N/N=C2\S/C(=C\c3cccc(OCc4ccccc4)c3)C(=O)N2Cc2ccco2)ccc1OCC(C)C |
| InChI | InChI=1S/C34H33N3O5S/c1-24(2)22-42-30-15-14-27(18-31(30)39-3)20-35-36-34-37(21-29-13-8-16-40-29)33(38)32(43-34)19-26-11-7-12-28(17-26)41-23-25-9-5-4-6-10-25/h4-20,24H,21-23H2,1-3H3/b32-19-,35-20+,36-34- |
| InChIKey | WXXPCPDBBUWZEA-WUFCRKOVSA-N |
| XLogP | 7.41 |
| TPSA | 85.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.72 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|