C29H23N3O4S — CID 135772819
(2E,5Z)-3-(furan-2-ylmethyl)-2-[(Z)-(4-hydroxyphenyl)methylidenehydrazinylidene]-5-[(3-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135772819) has the molecular formula C29H23N3O4S and a molecular weight of 509.59 g/mol. Its IUPAC name is (2E,5Z)-3-(furan-2-ylmethyl)-2-[(Z)-(4-hydroxyphenyl)methylidenehydrazinylidene]-5-[(3-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-3-(furan-2-ylmethyl)-2-[(Z)-(4-hydroxyphenyl)methylidenehydrazinylidene]-5-[(3-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135772819 |
| Molecular Formula | C29H23N3O4S |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | (2E,5Z)-3-(furan-2-ylmethyl)-2-[(Z)-(4-hydroxyphenyl)methylidenehydrazinylidene]-5-[(3-phenylmethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cccc(OCc3ccccc3)c2)S/C(=N/N=C\c2ccc(O)cc2)N1Cc1ccco1 |
| InChI | InChI=1S/C29H23N3O4S/c33-24-13-11-21(12-14-24)18-30-31-29-32(19-26-10-5-15-35-26)28(34)27(37-29)17-23-8-4-9-25(16-23)36-20-22-6-2-1-3-7-22/h1-18,33H,19-20H2/b27-17-,30-18-,31-29+ |
| InChIKey | XCYIHLMBXOJULP-UDMQHDPMSA-N |
| XLogP | 6.07 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|