C24H20Br2N4O3S — CID 135773144
(2E,5Z)-2-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-5-[[4-(dimethylamino)phenyl]methylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one (PubChem CID 135773144) has the molecular formula C24H20Br2N4O3S and a molecular weight of 604.32 g/mol. Its IUPAC name is (2E,5Z)-2-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-5-[[4-(dimethylamino)phenyl]methylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-2-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-5-[[4-(dimethylamino)phenyl]methylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135773144 |
| Molecular Formula | C24H20Br2N4O3S |
| Molecular Weight | 604.32 g/mol |
| Exact Mass | 601.96 |
| IUPAC Name | (2E,5Z)-2-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-5-[[4-(dimethylamino)phenyl]methylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
| SMILES | CN(C)c1ccc(/C=C2\S/C(=N/N=C\c3cc(Br)cc(Br)c3O)N(Cc3ccco3)C2=O)cc1 |
| InChI | InChI=1S/C24H20Br2N4O3S/c1-29(2)18-7-5-15(6-8-18)10-21-23(32)30(14-19-4-3-9-33-19)24(34-21)28-27-13-16-11-17(25)12-20(26)22(16)31/h3-13,31H,14H2,1-2H3/b21-10-,27-13-,28-24+ |
| InChIKey | SZOWJOIMUKKTDC-FXADJXAASA-N |
| XLogP | 6.08 |
| TPSA | 81.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.32 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|