C22H14Br3N3O4S — CID 135773142
(2E,5Z)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-2-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one (PubChem CID 135773142) has the molecular formula C22H14Br3N3O4S and a molecular weight of 656.15 g/mol. Its IUPAC name is (2E,5Z)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-2-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-2-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135773142 |
| Molecular Formula | C22H14Br3N3O4S |
| Molecular Weight | 656.15 g/mol |
| Exact Mass | 652.83 |
| IUPAC Name | (2E,5Z)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-2-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cc(Br)ccc2O)S/C(=N/N=C\c2cc(Br)cc(Br)c2O)N1Cc1ccco1 |
| InChI | InChI=1S/C22H14Br3N3O4S/c23-14-3-4-18(29)12(6-14)8-19-21(31)28(11-16-2-1-5-32-16)22(33-19)27-26-10-13-7-15(24)9-17(25)20(13)30/h1-10,29-30H,11H2/b19-8-,26-10-,27-22+ |
| InChIKey | LBLHWUXVLNFFQW-PCFCNJCISA-N |
| XLogP | 6.48 |
| TPSA | 98.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.15 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|