C22H15BrClN3O4S — CID 135773097
(2E,5Z)-2-[(Z)-(5-bromo-2-hydroxyphenyl)methylidenehydrazinylidene]-5-[(5-chloro-2-hydroxyphenyl)methylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one (PubChem CID 135773097) has the molecular formula C22H15BrClN3O4S and a molecular weight of 532.80 g/mol. Its IUPAC name is (2E,5Z)-2-[(Z)-(5-bromo-2-hydroxyphenyl)methylidenehydrazinylidene]-5-[(5-chloro-2-hydroxyphenyl)methylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-2-[(Z)-(5-bromo-2-hydroxyphenyl)methylidenehydrazinylidene]-5-[(5-chloro-2-hydroxyphenyl)methylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135773097 |
| Molecular Formula | C22H15BrClN3O4S |
| Molecular Weight | 532.80 g/mol |
| Exact Mass | 530.97 |
| IUPAC Name | (2E,5Z)-2-[(Z)-(5-bromo-2-hydroxyphenyl)methylidenehydrazinylidene]-5-[(5-chloro-2-hydroxyphenyl)methylidene]-3-(furan-2-ylmethyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cc(Cl)ccc2O)S/C(=N/N=C\c2cc(Br)ccc2O)N1Cc1ccco1 |
| InChI | InChI=1S/C22H15BrClN3O4S/c23-15-3-5-19(29)14(8-15)11-25-26-22-27(12-17-2-1-7-31-17)21(30)20(32-22)10-13-9-16(24)4-6-18(13)28/h1-11,28-29H,12H2/b20-10-,25-11-,26-22+ |
| InChIKey | FTLSRKBBUXZOGO-WDELQTTBSA-N |
| XLogP | 5.61 |
| TPSA | 98.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.80 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|