C25H20BrN3O3S — CID 16628507
(2Z,5Z)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(E)-[(E)-2-methyl-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 16628507) has the molecular formula C25H20BrN3O3S and a molecular weight of 522.42 g/mol. Its IUPAC name is (2Z,5Z)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(E)-[(E)-2-methyl-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5Z)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(E)-[(E)-2-methyl-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16628507 |
| Molecular Formula | C25H20BrN3O3S |
| Molecular Weight | 522.42 g/mol |
| Exact Mass | 521.04 |
| IUPAC Name | (2Z,5Z)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-3-(furan-2-ylmethyl)-2-[(E)-[(E)-2-methyl-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CC(/C=N/N=C1\S/C(=C\c2cc(Br)ccc2O)C(=O)N1Cc1ccco1)=C\c1ccccc1 |
| InChI | InChI=1S/C25H20BrN3O3S/c1-17(12-18-6-3-2-4-7-18)15-27-28-25-29(16-21-8-5-11-32-21)24(31)23(33-25)14-19-13-20(26)9-10-22(19)30/h2-15,30H,16H2,1H3/b17-12+,23-14-,27-15+,28-25- |
| InChIKey | JRUSUEUNAYZKSZ-PSPJAUMHSA-N |
| XLogP | 6.31 |
| TPSA | 78.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.42 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|